All categories

2 years ago

Consider the following system at equilibrium:

Chemistry

1 answer:

alexgriva [62]2 years ago

6 0

Answer:

A - Increase (R), Decrease (P), Decrease(q), Triple both (Q) and (R)

B - Increase(P), Increase(q), Decrease (R)

C - Triple (P) and reduce (q) to one third

Explanation:

According to Le Chatelier principle, when a system is in equilibrium and one of the constraints that affect the rate of reaction is applied, the equilibrium will shift so as to annul the effects of the constraint.

P and Q are reactants, an increase in either or both without an equally measurable increase in R (a product) will shift the equilibrium to the right. Also, any decrease in R without a corresponding decrease in either or both of P and Q will shift the equilibrium to the right. Hence, Increase(P), Increase(q), and Decrease (R) will shift the equilibrium to the right.

In the same vein, any increase in R without a corresponding increase in P and Q will shift the equilibrium to the left. The same goes for any decrease in either or both of P and Q without a counter-decrease in R will shift the equilibrium to the left. Hence, Increase (R), Decrease (P), Decrease(q), and Triple both (Q) and (R) will shift the equilibrium to the left.

Any increase or decrease in P with a commensurable decrease or increase in Q (or vice versa) with R remaining constant will create no shift in the equilibrium. Hence, Triple (P) and reduce (q) to one third will create no shift in the equilibrium.

You might be interested in

Determine the PH at the point in the titration of 40.0ml of 0.200M HC4H7o2 with 0.100 M Sr(OH)2 after 100ml of the strong base h

Dmitriy789 [7]

Answer:

Check the explanation

Explanation:

Mols HC4H7O2 = (volume in L)*(molarity) = (40.0 mL)*(0.200 M)

= (40.0 mL)*(1 L)/(1000 mL)*(0.200 M)

= 8.00*10-3 mol.

Mols Sr(OH)2 corresponding to 10.0 mL of 0.100 M solution =

(volume in L)*(molarity)

= (10.0 mL)*(0.100 M)

= (10.0 mL)*(1 L)/(1000 mL)*(0.100 M)

= 1.00*10-3 mol.

Consider the ionization of Sr(OH)2 as below.

Sr(OH)2 (aq) ----------> Sr2+ (aq) + 2 OH- (aq)

As per the stoichiometric equation,

1 mol Sr(OH)2 = 2 mols OH-.

Therefore,

0.0010 mol Sr(OH)2 = [0.0010 mol Sr(OH)2]*(2 mols OH-)/[1 mole Sr(OH)2]

= 0.0020 mol

= 2.00*10-3 mol

Set up the ICE charts as below.

HC4H7O2 (aq) + OH- (aq) ------------> H2O (l) + C4H7O2- (aq)

Before (mol) 8.00*10-3 2.00*10-3 - -

Change (mol) -2.00*10-3 -2.00*10-3 - +2.00*10-3

After (mol) 6.00*10-3 0 - 2.00*10-3

The change in a pure substance, e.g., H2O is not considered in an acid-base reaction.

Volume of the solution = (40.0 + 10.0) mL = 50.0 mL = (50.0 mL)*(1 L)/(1000 mL) = 0.05 L.

The initial concentrations are obtained by dividing the numbers of moles by the volume, 0.05 L.

Set up the ICE charts as below.

HC4H7O2 (aq) + OH- (aq) ------------> H2O (l) + C4H7O2- (aq)

Initial (M) 0.160 0.0400 - -

Change (M) -0.0400 -0.0400 - +0.0400

Equilibrium (M) 0.120 0 - 0.0400

The acid-ionization constant is written as

Ka = [H3O+][C4H7O2-]/[HC4H7O2] = 1.5*10-5

Plug in the known values and get

Ka = [H3O+]*(0.0400)/(0.120) = 1.5*10-5

======> [H3O+] = (1.5*10-5)*(0.120)/(0.0400) (ignore units)

======> [H3O+] = 4.5*10-5

The proton concentration of the solution is 4.5*10-5 M.

pH = -log (4.5*10-5 M)

= 4.346

≈ 4.35 (ans).

8 0

2 years ago

How much energy is required to heat 0.24 KG lutetium from 296.2K to 373.5 K? The specific heat for lutetium is 0.154 J/g-K

Olenka [21]

I’m not sure I need help with this question

6 0

2 years ago

A 1.0 x 102- gram sample is found to be pure alanine, an amino acid found in proteins. How many moles of alanine are in the samp

Romashka-Z-Leto [24]

Answer:

1.123x10⁻⁴ moles of alanine

Explanation:

In order to convert grams of alanine into moles, we need to know its molecular weight:

The formula for alanine is C₃H₇NO₂, meaning its molecular weight would be:

12*3 + 7*1 + 14 + 16*2 = 89 g/mol

Then we divide the sample mass by the molecular weight, to do the conversion:

1.0x10⁻² g ÷ 89 g/mol = 1.123x10⁻⁴ moles

4 0

1 year ago

The volume of blood plasma in adults is 3.1 L. it's density is 1.03 g/cm3. Approximately how many pounds of blood plasma are the

e-lub [12.9K]

The important thing in this question is the unit. The mass equals density * volume. 3.1 L = 3.1 * 10^3 cm3. So the mass is 3.193*10^3 g. 1 pound = 453.95 g. So the answer is 7.04 pounds.

3 0

2 years ago

Read 2 more answers

Describe the many different forms of energy involved with stretching and releasing a rubber band. What other processes are simil

Nadya [2.5K]

Answer:

Conversion of kinetic energy to potential energy (chemo mechanical energy)

In the state of rest, the rubber is a tangled mass of long chained cross-linked polymer that due to their disorderliness are in a state of increased entropy. By pulling on the polymer, the applied kinetic energy stretches the polymer into straight chains, giving them order and reducing their entropy. The stretched rubber then has energy stored in the form of chemo mechanical energy which is a form of potential energy

Conversion of the stored potential energy in the stretched to kinetic energy

By remaining in a stretched condition, the rubber is in a state of high potential energy, when the force holding the rubber in place is removed, due to the laws of thermodynamics, the polymers in the rubber curls back to their state of "random" tangled mass releasing the stored potential energy in the process and doing work such as moving items placed in the rubber's path of motion such as an object that has weight, w then takes up the kinetic energy 1/2×m×v² which can can result in the flight of the object.

Explanation:

5 0

2 years ago

Read 2 more answers