Ask question

Ask question

All categories

2 years ago

9

- Equilibrium shifts for slightly soluble compounds The reaction for the formation of a saturated solution of silver bromide (Ag

Br) can be represented as AgBr(s)?Ag+(aq)+Br?(aq)
Consider that this reaction is an endothermic process and that the AgBr solution is saturated.

Classify the following changes based on whether they will favor the formation of reactant, whether they will favor the formation of products, or whether they will have no effect on the equilibrium.

1. Adding hydrobromic acid (HBr)

2. Lowering the concentration of bromide (Br-) ions

3. Heating the concentrations

4. Adding solid silver bromide (AgBr)

5. Removing silver (Ag+) ions

1 answer:

RideAnS [48]2 years ago

3 0

Answer:

1) Favor formation of reactant

2) Favor formation of product

3) Favor formation of product

4) Favor formation of product

5) Favor formation of product

Explanation:

The reaction is $AgBr(s)--->Ag^{+}(aq)+Br^{-}(aq)$

The reaction is endothermic

1. Adding hydrobromic acid (HBr)

It will increase the amount of bromide ion. Bromide ion is one of the product so it will favor formation of reactant.

2. Lowering the concentration of bromide (Br-) ions

As we are decreasing the the concentration of product it will favor formation of more products

3. Heating the concentrations

If we are heating the mixture, it will increase the temperature and it will favor endothermic reaction. Thus will favor formation of product.

4. Adding solid silver bromide (AgBr)

If we are adding silver bromide it means we are increasing the concentration of reactant, it will favor formation of products

5. Removing silver (Ag+) ions

Removing silver ions means we are decreasing the concentration of product thus it will favor formation of products.

You might be interested in

Acetone is one of the most important solvents in organic chemistry. It is used to dissolve everything from fats and waxes to air

Yanka [14]

Answer: a. 79.6 s

b. 44.3 s

c. 191 s

Explanation:

Expression for rate law for first order kinetics is given by:

$t=\frac{2.303}{k}\log\frac{a}{a-x}$

where,

k = rate constant

t = age of sample

a = let initial amount of the reactant

a - x = amount left after decay process

a) for completion of half life:

Half life is the amount of time taken by a radioactive material to decay to half of its original value.

$t_{\frac{1}{2}}=\frac{0.693}{k}$

$t_{\frac{1}{2}}=\frac{0.693}{8.7\times 10^{-3}s^{-1}}=79.6s$

b) for completion of 32% of reaction

$t=\frac{2.303}{k}\log\frac{100}{100-32}$

$t=\frac{2.303}{8.7\times 10^{-3}}\log\frac{100}{68}$

$t=44.3s$

c) for completion of 81 % of reaction

$t=\frac{2.303}{k}\log\frac{100}{100-81}$

$t=\frac{2.303}{8.7\times 10^{-3}}\log\frac{100}{19}$

$t=191s$

4 0

1 year ago

Determine the PH at the point in the titration of 40.0ml of 0.200M HC4H7o2 with 0.100 M Sr(OH)2 after 100ml of the strong base h

Dmitriy789 [7]

Answer:

Check the explanation

Explanation:

Mols HC4H7O2 = (volume in L)*(molarity) = (40.0 mL)*(0.200 M)

= (40.0 mL)*(1 L)/(1000 mL)*(0.200 M)

= 8.00*10-3 mol.

Mols Sr(OH)2 corresponding to 10.0 mL of 0.100 M solution =

(volume in L)*(molarity)

= (10.0 mL)*(0.100 M)

= (10.0 mL)*(1 L)/(1000 mL)*(0.100 M)

= 1.00*10-3 mol.

Consider the ionization of Sr(OH)2 as below.

Sr(OH)2 (aq) ----------> Sr2+ (aq) + 2 OH- (aq)

As per the stoichiometric equation,

1 mol Sr(OH)2 = 2 mols OH-.

Therefore,

0.0010 mol Sr(OH)2 = [0.0010 mol Sr(OH)2]*(2 mols OH-)/[1 mole Sr(OH)2]

= 0.0020 mol

= 2.00*10-3 mol

Set up the ICE charts as below.

HC4H7O2 (aq) + OH- (aq) ------------> H2O (l) + C4H7O2- (aq)

Before (mol) 8.00*10-3 2.00*10-3 - -

Change (mol) -2.00*10-3 -2.00*10-3 - +2.00*10-3

After (mol) 6.00*10-3 0 - 2.00*10-3

The change in a pure substance, e.g., H2O is not considered in an acid-base reaction.

Volume of the solution = (40.0 + 10.0) mL = 50.0 mL = (50.0 mL)*(1 L)/(1000 mL) = 0.05 L.

The initial concentrations are obtained by dividing the numbers of moles by the volume, 0.05 L.

Set up the ICE charts as below.

HC4H7O2 (aq) + OH- (aq) ------------> H2O (l) + C4H7O2- (aq)

Initial (M) 0.160 0.0400 - -

Change (M) -0.0400 -0.0400 - +0.0400

Equilibrium (M) 0.120 0 - 0.0400

The acid-ionization constant is written as

Ka = [H3O+][C4H7O2-]/[HC4H7O2] = 1.5*10-5

Plug in the known values and get

Ka = [H3O+]*(0.0400)/(0.120) = 1.5*10-5

======> [H3O+] = (1.5*10-5)*(0.120)/(0.0400) (ignore units)

======> [H3O+] = 4.5*10-5

The proton concentration of the solution is 4.5*10-5 M.

pH = -log (4.5*10-5 M)

= 4.346

≈ 4.35 (ans).

8 0

2 years ago

the half-life of a certain radioactive element is 1250 years. what percent of the atom remains after 7500 years?

Olenka [21]

Maybe 24% not sure try researching it on google

8 0

2 years ago

To burn 1 molecule of C5H12 to form CO2 and H2O (complete combustion), how many molecules of O2 are required?

viva [34]

C5H12 + 8 O2 → 5 CO2 + 6 H2O

8 molecules of O2 are required.

5 0

2 years ago

Read 2 more answers

A piece of iron (mass = 25.0 g) at 398 k is placed in a styrofoam coffee cup containing 25.0 ml of water at 298 k. assuming that

Firlakuza [10]

The final temperature of the water is the equilibrium temperature, or the also the final temperature of the iron after a long period of time. Applying the conservation of energy:

m,iron*C,iron*ΔT = - m,water*C,water*ΔT

The density of water is 1000 g/mL.

(25 g)(0.449 J/g·°C)(T - 398 K) = - (25 mL)(1000 g/mL)(4.18 J/g·°C)(T - 298)
Solving for T,
<em>T = 298.01 K</em>

6 0

2 years ago

Read 2 more answers